About [dichloro(phenyl)silyl] N-cyclohexylcarbamate
[dichloro(phenyl)silyl] N-cyclohexylcarbamate (PubChem CID 22755494) has the molecular formula C13H17Cl2NO2Si
and a molecular weight of 318.28 g/mol. Its IUPAC name is [dichloro(phenyl)silyl] N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | [dichloro(phenyl)silyl] N-cyclohexylcarbamate |
| PubChem CID | 22755494 |
| Molecular Formula | C13H17Cl2NO2Si |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | [dichloro(phenyl)silyl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)O[Si](Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C13H17Cl2NO2Si/c14-19(15,12-9-5-2-6-10-12)18-13(17)16-11-7-3-1-4-8-11/h2,5-6,9-11H,1,3-4,7-8H2,(H,16,17) |
| InChIKey | LSJSEOULKWUGCV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze [dichloro(phenyl)silyl] N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dichloro(phenyl)silyl] N-cyclohexylcarbamate?
The IUPAC name of [dichloro(phenyl)silyl] N-cyclohexylcarbamate (CID 22755494) is [dichloro(phenyl)silyl] N-cyclohexylcarbamate.
What is the SMILES notation for [dichloro(phenyl)silyl] N-cyclohexylcarbamate?
The canonical SMILES for [dichloro(phenyl)silyl] N-cyclohexylcarbamate is O=C(NC1CCCCC1)O[Si](Cl)(Cl)c1ccccc1.
What is the InChIKey of [dichloro(phenyl)silyl] N-cyclohexylcarbamate?
The InChIKey is LSJSEOULKWUGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Cl2NO2Si/c14-19(15,12-9-5-2-6-10-12)18-13(17)16-11-7-3-1-4-8-11/h2,5-6,9-11H,1,3-4,7-8H2,(H,16,17).
What are the key properties of [dichloro(phenyl)silyl] N-cyclohexylcarbamate?
[dichloro(phenyl)silyl] N-cyclohexylcarbamate has a molecular weight of 318.28 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dichloro(phenyl)silyl] N-cyclohexylcarbamate is sourced from PubChem (CID 22755494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).