C24H39N — CID 22755519
(1E,3E)-N,N-bis[(1E,3E)-octa-1,3-dienyl]octa-1,3-dien-1-amine (PubChem CID 22755519) has the molecular formula C24H39N and a molecular weight of 341.58 g/mol. Its IUPAC name is (1E,3E)-N,N-bis[(1E,3E)-octa-1,3-dienyl]octa-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N,N-bis[(1E,3E)-octa-1,3-dienyl]octa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 22755519 |
| Molecular Formula | C24H39N |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 341.31 |
| IUPAC Name | (1E,3E)-N,N-bis[(1E,3E)-octa-1,3-dienyl]octa-1,3-dien-1-amine |
| SMILES | CCCC/C=C/C=C/N(/C=C/C=C/CCCC)/C=C/C=C/CCCC |
| InChI | InChI=1S/C24H39N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h13-24H,4-12H2,1-3H3/b16-13+,17-14+,18-15+,22-19+,23-20+,24-21+ |
| InChIKey | QJZWNPDQSYUVRJ-OEFTXHNJSA-N |
| XLogP | 8.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|