About 2-ethenyloxane-3,4,5-triol
2-ethenyloxane-3,4,5-triol (PubChem CID 22755840) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 2-ethenyloxane-3,4,5-triol.
Molecular Properties
| Compound Name | 2-ethenyloxane-3,4,5-triol |
| PubChem CID | 22755840 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 2-ethenyloxane-3,4,5-triol |
| SMILES | C=CC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C7H12O4/c1-2-5-7(10)6(9)4(8)3-11-5/h2,4-10H,1,3H2 |
| InChIKey | UUIJGCBYUULRNG-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyloxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyloxane-3,4,5-triol?
The IUPAC name of 2-ethenyloxane-3,4,5-triol (CID 22755840) is 2-ethenyloxane-3,4,5-triol.
What is the SMILES notation for 2-ethenyloxane-3,4,5-triol?
The canonical SMILES for 2-ethenyloxane-3,4,5-triol is C=CC1OCC(O)C(O)C1O.
What is the InChIKey of 2-ethenyloxane-3,4,5-triol?
The InChIKey is UUIJGCBYUULRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-2-5-7(10)6(9)4(8)3-11-5/h2,4-10H,1,3H2.
What are the key properties of 2-ethenyloxane-3,4,5-triol?
2-ethenyloxane-3,4,5-triol has a molecular weight of 160.17 g/mol, XLogP of -1.35, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyloxane-3,4,5-triol is sourced from PubChem (CID 22755840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).