C17H30N2O — CID 22755846
N-cyclohexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide (PubChem CID 22755846) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is N-cyclohexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide.
| Compound Name | N-cyclohexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide |
|---|---|
| PubChem CID | 22755846 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | N-cyclohexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide |
| SMILES | CC1(C)CC(=CC(=O)NC2CCCCC2)CC(C)(C)N1 |
| InChI | InChI=1S/C17H30N2O/c1-16(2)11-13(12-17(3,4)19-16)10-15(20)18-14-8-6-5-7-9-14/h10,14,19H,5-9,11-12H2,1-4H3,(H,18,20) |
| InChIKey | PFSLUDGLENLLGI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|