C18H34N2O — CID 22755860
N-hexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide (PubChem CID 22755860) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is N-hexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide.
| Compound Name | N-hexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide |
|---|---|
| PubChem CID | 22755860 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | N-hexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide |
| SMILES | CCCCCCNC(=O)C=C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C18H34N2O/c1-7-8-9-10-11-19-16(21)12-15-13-17(2,3)20(6)18(4,5)14-15/h12H,7-11,13-14H2,1-6H3,(H,19,21) |
| InChIKey | ZZBQZAOIBIEZOS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|