C14H24N2O — CID 22755867
N-prop-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide (PubChem CID 22755867) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-prop-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide.
| Compound Name | N-prop-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide |
|---|---|
| PubChem CID | 22755867 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-prop-2-enyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide |
| SMILES | C=CCNC(=O)C=C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C14H24N2O/c1-6-7-15-12(17)8-11-9-13(2,3)16-14(4,5)10-11/h6,8,16H,1,7,9-10H2,2-5H3,(H,15,17) |
| InChIKey | TWTDBFIGHXXXKD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|