C24H42N4O2 — CID 22755888
2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[2-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide (PubChem CID 22755888) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[2-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[2-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22755888 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-ylidene)-N-[2-[[2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetyl]amino]ethyl]acetamide |
| SMILES | CC1(C)CC(=CC(=O)NCCNC(=O)C=C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C24H42N4O2/c1-21(2)13-17(14-22(3,4)27-21)11-19(29)25-9-10-26-20(30)12-18-15-23(5,6)28-24(7,8)16-18/h11-12,27-28H,9-10,13-16H2,1-8H3,(H,25,29)(H,26,30) |
| InChIKey | LHGKNLWKTCPFCC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|