C19H35NO2 — CID 22755900
2-(2,2,6,6-tetramethyl-1-octylpiperidin-4-ylidene)acetic acid (PubChem CID 22755900) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethyl-1-octylpiperidin-4-ylidene)acetic acid.
| Compound Name | 2-(2,2,6,6-tetramethyl-1-octylpiperidin-4-ylidene)acetic acid |
|---|---|
| PubChem CID | 22755900 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | 2-(2,2,6,6-tetramethyl-1-octylpiperidin-4-ylidene)acetic acid |
| SMILES | CCCCCCCCN1C(C)(C)CC(=CC(=O)O)CC1(C)C |
| InChI | InChI=1S/C19H35NO2/c1-6-7-8-9-10-11-12-20-18(2,3)14-16(13-17(21)22)15-19(20,4)5/h13H,6-12,14-15H2,1-5H3,(H,21,22) |
| InChIKey | LPHDCIPZPOZEFZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|