C17H32N2O — CID 22755904
N-hexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide (PubChem CID 22755904) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is N-hexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide.
| Compound Name | N-hexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide |
|---|---|
| PubChem CID | 22755904 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | N-hexyl-2-(2,2,6,6-tetramethylpiperidin-4-ylidene)acetamide |
| SMILES | CCCCCCNC(=O)C=C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C17H32N2O/c1-6-7-8-9-10-18-15(20)11-14-12-16(2,3)19-17(4,5)13-14/h11,19H,6-10,12-13H2,1-5H3,(H,18,20) |
| InChIKey | SNJSYJSDANTSSB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|