C18H32N2O — CID 22755907
N-cyclohexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide (PubChem CID 22755907) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-cyclohexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide.
| Compound Name | N-cyclohexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide |
|---|---|
| PubChem CID | 22755907 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-cyclohexyl-2-(1,2,2,6,6-pentamethylpiperidin-4-ylidene)acetamide |
| SMILES | CN1C(C)(C)CC(=CC(=O)NC2CCCCC2)CC1(C)C |
| InChI | InChI=1S/C18H32N2O/c1-17(2)12-14(13-18(3,4)20(17)5)11-16(21)19-15-9-7-6-8-10-15/h11,15H,6-10,12-13H2,1-5H3,(H,19,21) |
| InChIKey | ZLASBRJQTGSECO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|