About 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine
2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine (PubChem CID 22756043) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine.
Analyze 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine?
The IUPAC name of 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine (CID 22756043) is 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine.
What is the SMILES notation for 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine?
The canonical SMILES for 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine is C=CC1=NC(C)CC(C)N1C.
What is the InChIKey of 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine?
The InChIKey is OTLUXJPLMTWXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-5-9-10-7(2)6-8(3)11(9)4/h5,7-8H,1,6H2,2-4H3.
What are the key properties of 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine?
2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine has a molecular weight of 152.24 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1,4,6-trimethyl-5,6-dihydro-4H-pyrimidine is sourced from PubChem (CID 22756043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).