About 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane
5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane (PubChem CID 22756292) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane.
Molecular Properties
| Compound Name | 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane |
| PubChem CID | 22756292 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane |
| SMILES | C#CCCCC1CCC(C2OCCO2)OCCO1 |
| InChI | InChI=1S/C14H22O4/c1-2-3-4-5-12-6-7-13(16-9-8-15-12)14-17-10-11-18-14/h1,12-14H,3-11H2 |
| InChIKey | KJLPHFAMIBVTSL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane?
The IUPAC name of 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane (CID 22756292) is 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane.
What is the SMILES notation for 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane?
The canonical SMILES for 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane is C#CCCCC1CCC(C2OCCO2)OCCO1.
What is the InChIKey of 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane?
The InChIKey is KJLPHFAMIBVTSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-2-3-4-5-12-6-7-13(16-9-8-15-12)14-17-10-11-18-14/h1,12-14H,3-11H2.
What are the key properties of 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane?
5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane has a molecular weight of 254.33 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxolan-2-yl)-8-pent-4-ynyl-1,4-dioxocane is sourced from PubChem (CID 22756292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).