About 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine
6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine (PubChem CID 22756857) has the molecular formula C14H13ClN4
and a molecular weight of 272.74 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine |
| PubChem CID | 22756857 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine |
| SMILES | CNc1cc(-c2ccc(Cl)cc2)nc2nn(C)cc12 |
| InChI | InChI=1S/C14H13ClN4/c1-16-13-7-12(9-3-5-10(15)6-4-9)17-14-11(13)8-19(2)18-14/h3-8,16H,1-2H3 |
| InChIKey | GIVNNIMJBIFQRZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine?
The IUPAC name of 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine (CID 22756857) is 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine.
What is the SMILES notation for 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine?
The canonical SMILES for 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine is CNc1cc(-c2ccc(Cl)cc2)nc2nn(C)cc12.
What is the InChIKey of 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine?
The InChIKey is GIVNNIMJBIFQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN4/c1-16-13-7-12(9-3-5-10(15)6-4-9)17-14-11(13)8-19(2)18-14/h3-8,16H,1-2H3.
What are the key properties of 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine?
6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine has a molecular weight of 272.74 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-N,2-dimethylpyrazolo[3,4-b]pyridin-4-amine is sourced from PubChem (CID 22756857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).