About 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine
1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine (PubChem CID 22757039) has the molecular formula C27H53N3OSn
and a molecular weight of 554.45 g/mol. Its IUPAC name is 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine |
| PubChem CID | 22757039 |
| Molecular Formula | C27H53N3OSn |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine |
| SMILES | CCCC[Sn](CCCC)(CCCC)Oc1c(CN(C)C)cc(CN(C)C)cc1CN(C)C |
| InChI | InChI=1S/C15H27N3O.3C4H9.Sn/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6;3*1-3-4-2;/h7-8,19H,9-11H2,1-6H3;3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | FZLPEHAJTDMGEB-UHFFFAOYSA-M |
| XLogP | 6.60 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine?
The IUPAC name of 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine (CID 22757039) is 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine.
What is the SMILES notation for 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine?
The canonical SMILES for 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine is CCCC[Sn](CCCC)(CCCC)Oc1c(CN(C)C)cc(CN(C)C)cc1CN(C)C.
What is the InChIKey of 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine?
The InChIKey is FZLPEHAJTDMGEB-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H27N3O.3C4H9.Sn/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6;3*1-3-4-2;/h7-8,19H,9-11H2,1-6H3;3*1,3-4H2,2H3;/q;;;;+1/p-1.
What are the key properties of 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine?
1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine has a molecular weight of 554.45 g/mol, XLogP of 6.60, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis[(dimethylamino)methyl]-4-tributylstannyloxyphenyl]-N,N-dimethylmethanamine is sourced from PubChem (CID 22757039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).