About 3-(2-bromoethyl)-1,3-oxazolidin-2-one
3-(2-bromoethyl)-1,3-oxazolidin-2-one (PubChem CID 22757234) has the molecular formula C5H8BrNO2
and a molecular weight of 194.03 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(2-bromoethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 22757234 |
| Molecular Formula | C5H8BrNO2 |
| Molecular Weight | 194.03 g/mol |
| Exact Mass | 192.97 |
| IUPAC Name | 3-(2-bromoethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CCBr |
| InChI | InChI=1S/C5H8BrNO2/c6-1-2-7-3-4-9-5(7)8/h1-4H2 |
| InChIKey | WDEXBUYVNOGGEE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.03 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromoethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromoethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(2-bromoethyl)-1,3-oxazolidin-2-one (CID 22757234) is 3-(2-bromoethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(2-bromoethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(2-bromoethyl)-1,3-oxazolidin-2-one is O=C1OCCN1CCBr.
What is the InChIKey of 3-(2-bromoethyl)-1,3-oxazolidin-2-one?
The InChIKey is WDEXBUYVNOGGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrNO2/c6-1-2-7-3-4-9-5(7)8/h1-4H2.
What are the key properties of 3-(2-bromoethyl)-1,3-oxazolidin-2-one?
3-(2-bromoethyl)-1,3-oxazolidin-2-one has a molecular weight of 194.03 g/mol, XLogP of 0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromoethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 22757234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).