About 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid
2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid (PubChem CID 22757263) has the molecular formula C18H23NO2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid |
| PubChem CID | 22757263 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid |
| SMILES | CCn1c2c(c3ccccc31)CCCC2(C)C(C)C(=O)O |
| InChI | InChI=1S/C18H23NO2/c1-4-19-15-10-6-5-8-13(15)14-9-7-11-18(3,16(14)19)12(2)17(20)21/h5-6,8,10,12H,4,7,9,11H2,1-3H3,(H,20,21) |
| InChIKey | MJUXONWQRMQJGS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid?
The IUPAC name of 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid (CID 22757263) is 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid.
What is the SMILES notation for 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid?
The canonical SMILES for 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid is CCn1c2c(c3ccccc31)CCCC2(C)C(C)C(=O)O.
What is the InChIKey of 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid?
The InChIKey is MJUXONWQRMQJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO2/c1-4-19-15-10-6-5-8-13(15)14-9-7-11-18(3,16(14)19)12(2)17(20)21/h5-6,8,10,12H,4,7,9,11H2,1-3H3,(H,20,21).
What are the key properties of 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid?
2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid has a molecular weight of 285.39 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9-ethyl-1-methyl-3,4-dihydro-2H-carbazol-1-yl)propanoic acid is sourced from PubChem (CID 22757263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).