C13H12N6O — CID 22757489
4,7,13-trimethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one (PubChem CID 22757489) has the molecular formula C13H12N6O and a molecular weight of 268.28 g/mol. Its IUPAC name is 4,7,13-trimethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one.
| Compound Name | 4,7,13-trimethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one |
|---|---|
| PubChem CID | 22757489 |
| Molecular Formula | C13H12N6O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4,7,13-trimethyl-2,3,7,11,13,14-hexazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,9,11,14-hexaen-8-one |
| SMILES | Cc1cc2n(C)c(=O)c3cnc4c(cnn4C)c3n2n1 |
| InChI | InChI=1S/C13H12N6O/c1-7-4-10-17(2)13(20)9-5-14-12-8(6-15-18(12)3)11(9)19(10)16-7/h4-6H,1-3H3 |
| InChIKey | ZFCDPQXSCPOINJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |