About 4,5-dichloro-2,3-dihydro-1H-inden-1-ol
4,5-dichloro-2,3-dihydro-1H-inden-1-ol (PubChem CID 22757692) has the molecular formula C9H8Cl2O
and a molecular weight of 203.07 g/mol. Its IUPAC name is 4,5-dichloro-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 4,5-dichloro-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 22757692 |
| Molecular Formula | C9H8Cl2O |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 4,5-dichloro-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C9H8Cl2O/c10-7-3-1-5-6(9(7)11)2-4-8(5)12/h1,3,8,12H,2,4H2 |
| InChIKey | WDADKGIADWWPGI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dichloro-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 4,5-dichloro-2,3-dihydro-1H-inden-1-ol (CID 22757692) is 4,5-dichloro-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 4,5-dichloro-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 4,5-dichloro-2,3-dihydro-1H-inden-1-ol is OC1CCc2c1ccc(Cl)c2Cl.
What is the InChIKey of 4,5-dichloro-2,3-dihydro-1H-inden-1-ol?
The InChIKey is WDADKGIADWWPGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2O/c10-7-3-1-5-6(9(7)11)2-4-8(5)12/h1,3,8,12H,2,4H2.
What are the key properties of 4,5-dichloro-2,3-dihydro-1H-inden-1-ol?
4,5-dichloro-2,3-dihydro-1H-inden-1-ol has a molecular weight of 203.07 g/mol, XLogP of 2.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 22757692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).