About 1-cyanoethylcarbamothioic S-acid
1-cyanoethylcarbamothioic S-acid (PubChem CID 22757794) has the molecular formula C4H6N2OS
and a molecular weight of 130.17 g/mol. Its IUPAC name is 1-cyanoethylcarbamothioic S-acid.
Molecular Properties
| Compound Name | 1-cyanoethylcarbamothioic S-acid |
| PubChem CID | 22757794 |
| Molecular Formula | C4H6N2OS |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.02 |
| IUPAC Name | 1-cyanoethylcarbamothioic S-acid |
| SMILES | CC(C#N)NC(=O)S |
| InChI | InChI=1S/C4H6N2OS/c1-3(2-5)6-4(7)8/h3H,1H3,(H2,6,7,8) |
| InChIKey | LCIDPJQPEBTGIV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoethylcarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoethylcarbamothioic S-acid?
The IUPAC name of 1-cyanoethylcarbamothioic S-acid (CID 22757794) is 1-cyanoethylcarbamothioic S-acid.
What is the SMILES notation for 1-cyanoethylcarbamothioic S-acid?
The canonical SMILES for 1-cyanoethylcarbamothioic S-acid is CC(C#N)NC(=O)S.
What is the InChIKey of 1-cyanoethylcarbamothioic S-acid?
The InChIKey is LCIDPJQPEBTGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2OS/c1-3(2-5)6-4(7)8/h3H,1H3,(H2,6,7,8).
What are the key properties of 1-cyanoethylcarbamothioic S-acid?
1-cyanoethylcarbamothioic S-acid has a molecular weight of 130.17 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoethylcarbamothioic S-acid is sourced from PubChem (CID 22757794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).