About 1,4-oxathiine 4,4-dioxide
1,4-oxathiine 4,4-dioxide (PubChem CID 22757882) has the molecular formula C4H4O3S
and a molecular weight of 132.14 g/mol. Its IUPAC name is 1,4-oxathiine 4,4-dioxide.
Molecular Properties
| Compound Name | 1,4-oxathiine 4,4-dioxide |
| PubChem CID | 22757882 |
| Molecular Formula | C4H4O3S |
| Molecular Weight | 132.14 g/mol |
| Exact Mass | 131.99 |
| IUPAC Name | 1,4-oxathiine 4,4-dioxide |
| SMILES | O=S1(=O)C=COC=C1 |
| InChI | InChI=1S/C4H4O3S/c5-8(6)3-1-7-2-4-8/h1-4H |
| InChIKey | XAUJKHRXXGQLAJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.14 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-oxathiine 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-oxathiine 4,4-dioxide?
The IUPAC name of 1,4-oxathiine 4,4-dioxide (CID 22757882) is 1,4-oxathiine 4,4-dioxide.
What is the SMILES notation for 1,4-oxathiine 4,4-dioxide?
The canonical SMILES for 1,4-oxathiine 4,4-dioxide is O=S1(=O)C=COC=C1.
What is the InChIKey of 1,4-oxathiine 4,4-dioxide?
The InChIKey is XAUJKHRXXGQLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O3S/c5-8(6)3-1-7-2-4-8/h1-4H.
What are the key properties of 1,4-oxathiine 4,4-dioxide?
1,4-oxathiine 4,4-dioxide has a molecular weight of 132.14 g/mol, XLogP of 0.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-oxathiine 4,4-dioxide is sourced from PubChem (CID 22757882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).