C14H18F3NO — CID 22758132
2,2,2-trifluoro-N-[3-(2,3,4,7-tetrahydro-1H-inden-1-yl)propyl]acetamide (PubChem CID 22758132) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(2,3,4,7-tetrahydro-1H-inden-1-yl)propyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(2,3,4,7-tetrahydro-1H-inden-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 22758132 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(2,3,4,7-tetrahydro-1H-inden-1-yl)propyl]acetamide |
| SMILES | O=C(NCCCC1CCC2=C1CC=CC2)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO/c15-14(16,17)13(19)18-9-3-5-11-8-7-10-4-1-2-6-12(10)11/h1-2,11H,3-9H2,(H,18,19) |
| InChIKey | BTUPWVYCHUDTCC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|