C19H17N7O — CID 22758527
13-ethyl-8-(2-phenylethoxy)-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene (PubChem CID 22758527) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 13-ethyl-8-(2-phenylethoxy)-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene.
| Compound Name | 13-ethyl-8-(2-phenylethoxy)-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene |
|---|---|
| PubChem CID | 22758527 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 13-ethyl-8-(2-phenylethoxy)-2,3,5,7,11,13,14-heptazatetracyclo[7.7.0.02,6.012,16]hexadeca-1(16),3,5,7,9,11,14-heptaene |
| SMILES | CCn1ncc2c1ncc1c(OCCc3ccccc3)nc3ncnn3c12 |
| InChI | InChI=1S/C19H17N7O/c1-2-25-17-14(11-22-25)16-15(10-20-17)18(24-19-21-12-23-26(16)19)27-9-8-13-6-4-3-5-7-13/h3-7,10-12H,2,8-9H2,1H3 |
| InChIKey | MTQSIIRILHITLO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |