C20H24N3OS+ — CID 22758599
1-benzyl-3-ethyl-6-phenyl-4,7-dihydro-2H-[1,3]thiazolo[3,2-a][1,3,5]triazin-1-ium-6-ol (PubChem CID 22758599) has the molecular formula C20H24N3OS+ and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-benzyl-3-ethyl-6-phenyl-4,7-dihydro-2H-[1,3]thiazolo[3,2-a][1,3,5]triazin-1-ium-6-ol.
| Compound Name | 1-benzyl-3-ethyl-6-phenyl-4,7-dihydro-2H-[1,3]thiazolo[3,2-a][1,3,5]triazin-1-ium-6-ol |
|---|---|
| PubChem CID | 22758599 |
| Molecular Formula | C20H24N3OS+ |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-benzyl-3-ethyl-6-phenyl-4,7-dihydro-2H-[1,3]thiazolo[3,2-a][1,3,5]triazin-1-ium-6-ol |
| SMILES | CCN1CN2C(=[N+](Cc3ccccc3)C1)SCC2(O)c1ccccc1 |
| InChI | InChI=1S/C20H24N3OS/c1-2-21-15-22(13-17-9-5-3-6-10-17)19-23(16-21)20(24,14-25-19)18-11-7-4-8-12-18/h3-12,24H,2,13-16H2,1H3/q+1 |
| InChIKey | GFGYTLNREYUMPD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|