About 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione
5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione (PubChem CID 22758603) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione.
Molecular Properties
| Compound Name | 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione |
| PubChem CID | 22758603 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione |
| SMILES | C=CCN1CN(CC)CNC1=S |
| InChI | InChI=1S/C8H15N3S/c1-3-5-11-7-10(4-2)6-9-8(11)12/h3H,1,4-7H2,2H3,(H,9,12) |
| InChIKey | IMGNTZPTLUMYCS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione?
The IUPAC name of 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione (CID 22758603) is 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione.
What is the SMILES notation for 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione?
The canonical SMILES for 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione is C=CCN1CN(CC)CNC1=S.
What is the InChIKey of 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione?
The InChIKey is IMGNTZPTLUMYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-3-5-11-7-10(4-2)6-9-8(11)12/h3H,1,4-7H2,2H3,(H,9,12).
What are the key properties of 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione?
5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione has a molecular weight of 185.30 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-prop-2-enyl-1,3,5-triazinane-2-thione is sourced from PubChem (CID 22758603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).