C20H11Cl2NO2S — CID 22759183
1-amino-5-(2,5-dichlorophenyl)sulfanylanthracene-9,10-dione (PubChem CID 22759183) has the molecular formula C20H11Cl2NO2S and a molecular weight of 400.29 g/mol. Its IUPAC name is 1-amino-5-(2,5-dichlorophenyl)sulfanylanthracene-9,10-dione.
| Compound Name | 1-amino-5-(2,5-dichlorophenyl)sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 22759183 |
| Molecular Formula | C20H11Cl2NO2S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 1-amino-5-(2,5-dichlorophenyl)sulfanylanthracene-9,10-dione |
| SMILES | Nc1cccc2c1C(=O)c1cccc(Sc3cc(Cl)ccc3Cl)c1C2=O |
| InChI | InChI=1S/C20H11Cl2NO2S/c21-10-7-8-13(22)16(9-10)26-15-6-2-4-12-18(15)20(25)11-3-1-5-14(23)17(11)19(12)24/h1-9H,23H2 |
| InChIKey | NOIIZEGQDJJDIZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|