About 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione
1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione (PubChem CID 22759192) has the molecular formula C24H13ClO3
and a molecular weight of 384.82 g/mol. Its IUPAC name is 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione |
| PubChem CID | 22759192 |
| Molecular Formula | C24H13ClO3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(Oc3cccc4cccc(Cl)c34)cccc21 |
| InChI | InChI=1S/C24H13ClO3/c25-18-11-3-6-14-7-4-12-19(21(14)18)28-20-13-5-10-17-22(20)24(27)16-9-2-1-8-15(16)23(17)26/h1-13H |
| InChIKey | OPPISTAFKRGXDV-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione?
The IUPAC name of 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione (CID 22759192) is 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione.
What is the SMILES notation for 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione?
The canonical SMILES for 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione is O=C1c2ccccc2C(=O)c2c(Oc3cccc4cccc(Cl)c34)cccc21.
What is the InChIKey of 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione?
The InChIKey is OPPISTAFKRGXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H13ClO3/c25-18-11-3-6-14-7-4-12-19(21(14)18)28-20-13-5-10-17-22(20)24(27)16-9-2-1-8-15(16)23(17)26/h1-13H.
What are the key properties of 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione?
1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione has a molecular weight of 384.82 g/mol, XLogP of 6.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-chloronaphthalen-1-yl)oxyanthracene-9,10-dione is sourced from PubChem (CID 22759192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).