About 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide
2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide (PubChem CID 22759466) has the molecular formula C12H14BrCl3N2
and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide.
Molecular Properties
| Compound Name | 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide |
| PubChem CID | 22759466 |
| Molecular Formula | C12H14BrCl3N2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 369.94 |
| IUPAC Name | 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide |
| SMILES | Br.ClCC(CC1=NCCN1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13Cl3N2.BrH/c13-7-8(6-11-16-4-5-17-11)12-9(14)2-1-3-10(12)15;/h1-3,8H,4-7H2,(H,16,17);1H |
| InChIKey | PLFBIYWWTURDGU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide?
The IUPAC name of 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide (CID 22759466) is 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide.
What is the SMILES notation for 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide?
The canonical SMILES for 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide is Br.ClCC(CC1=NCCN1)c1c(Cl)cccc1Cl.
What is the InChIKey of 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide?
The InChIKey is PLFBIYWWTURDGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl3N2.BrH/c13-7-8(6-11-16-4-5-17-11)12-9(14)2-1-3-10(12)15;/h1-3,8H,4-7H2,(H,16,17);1H.
What are the key properties of 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide?
2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide has a molecular weight of 372.52 g/mol, XLogP of 4.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-chloro-2-(2,6-dichlorophenyl)propyl]-4,5-dihydro-1H-imidazole;hydrobromide is sourced from PubChem (CID 22759466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).