C14H25NO2 — CID 22759880
2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl prop-2-enoate (PubChem CID 22759880) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl prop-2-enoate.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 22759880 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-1-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C14H25NO2/c1-6-12(16)17-11-10-15-13(2,3)8-7-9-14(15,4)5/h6H,1,7-11H2,2-5H3 |
| InChIKey | IQBUACMFVVBEAH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|