About 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone
2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone (PubChem CID 22759980) has the molecular formula C17H14Cl2FNO2
and a molecular weight of 354.21 g/mol. Its IUPAC name is 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone.
Molecular Properties
| Compound Name | 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone |
| PubChem CID | 22759980 |
| Molecular Formula | C17H14Cl2FNO2 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone |
| SMILES | O=C(CCl)N1CCOc2ccc(F)cc2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2FNO2/c18-10-16(22)21-7-8-23-15-6-5-13(20)9-14(15)17(21)11-1-3-12(19)4-2-11/h1-6,9,17H,7-8,10H2 |
| InChIKey | FOOWTBWPEWFSQR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone?
The IUPAC name of 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone (CID 22759980) is 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone.
What is the SMILES notation for 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone?
The canonical SMILES for 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone is O=C(CCl)N1CCOc2ccc(F)cc2C1c1ccc(Cl)cc1.
What is the InChIKey of 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone?
The InChIKey is FOOWTBWPEWFSQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14Cl2FNO2/c18-10-16(22)21-7-8-23-15-6-5-13(20)9-14(15)17(21)11-1-3-12(19)4-2-11/h1-6,9,17H,7-8,10H2.
What are the key properties of 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone?
2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone has a molecular weight of 354.21 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[5-(4-chlorophenyl)-7-fluoro-3,5-dihydro-2H-1,4-benzoxazepin-4-yl]ethanone is sourced from PubChem (CID 22759980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).