About 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one
2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one (PubChem CID 22760007) has the molecular formula C14H13NO4
and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| PubChem CID | 22760007 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one |
| SMILES | COc1ccc2c(c1)C(=O)NCC(c1ccco1)O2 |
| InChI | InChI=1S/C14H13NO4/c1-17-9-4-5-11-10(7-9)14(16)15-8-13(19-11)12-3-2-6-18-12/h2-7,13H,8H2,1H3,(H,15,16) |
| InChIKey | OGMATIGPFDINRR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The IUPAC name of 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one (CID 22760007) is 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one.
What is the SMILES notation for 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The canonical SMILES for 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one is COc1ccc2c(c1)C(=O)NCC(c1ccco1)O2.
What is the InChIKey of 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
The InChIKey is OGMATIGPFDINRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c1-17-9-4-5-11-10(7-9)14(16)15-8-13(19-11)12-3-2-6-18-12/h2-7,13H,8H2,1H3,(H,15,16).
What are the key properties of 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one?
2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one has a molecular weight of 259.26 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-7-methoxy-3,4-dihydro-2H-1,4-benzoxazepin-5-one is sourced from PubChem (CID 22760007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).