About [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate
[2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate (PubChem CID 22760250) has the molecular formula C7H8Br2F6O6S2
and a molecular weight of 526.07 g/mol. Its IUPAC name is [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
| PubChem CID | 22760250 |
| Molecular Formula | C7H8Br2F6O6S2 |
| Molecular Weight | 526.07 g/mol |
| Exact Mass | 523.80 |
| IUPAC Name | [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC(CBr)(CBr)COS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8Br2F6O6S2/c8-1-5(2-9,3-20-22(16,17)6(10,11)12)4-21-23(18,19)7(13,14)15/h1-4H2 |
| InChIKey | PQTZTRRVPHDVAX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
The IUPAC name of [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate (CID 22760250) is [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate.
What is the SMILES notation for [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
The canonical SMILES for [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate is O=S(=O)(OCC(CBr)(CBr)COS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
The InChIKey is PQTZTRRVPHDVAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Br2F6O6S2/c8-1-5(2-9,3-20-22(16,17)6(10,11)12)4-21-23(18,19)7(13,14)15/h1-4H2.
What are the key properties of [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate?
[2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate has a molecular weight of 526.07 g/mol, XLogP of 2.49, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-bis(bromomethyl)-3-(trifluoromethylsulfonyloxy)propyl] trifluoromethanesulfonate is sourced from PubChem (CID 22760250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).