C15H28O2 — CID 22761448
3-methyl-2,3,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b][1,4]dioxine (PubChem CID 22761448) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 3-methyl-2,3,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b][1,4]dioxine.
| Compound Name | 3-methyl-2,3,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b][1,4]dioxine |
|---|---|
| PubChem CID | 22761448 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 3-methyl-2,3,4a,5,6,7,8,9,10,11,12,13,14,14a-tetradecahydrocyclododeca[b][1,4]dioxine |
| SMILES | CC1COC2CCCCCCCCCCC2O1 |
| InChI | InChI=1S/C15H28O2/c1-13-12-16-14-10-8-6-4-2-3-5-7-9-11-15(14)17-13/h13-15H,2-12H2,1H3 |
| InChIKey | WLGVQKUOBHUCSS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |