About 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid
2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid (PubChem CID 22761566) has the molecular formula C9H8N2O3S2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid.
Molecular Properties
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid |
| PubChem CID | 22761566 |
| Molecular Formula | C9H8N2O3S2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid |
| SMILES | Nc1nc(-c2ccccc2S(=O)(=O)O)cs1 |
| InChI | InChI=1S/C9H8N2O3S2/c10-9-11-7(5-15-9)6-3-1-2-4-8(6)16(12,13)14/h1-5H,(H2,10,11)(H,12,13,14) |
| InChIKey | OAVJTNJQTFTWPS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid?
The IUPAC name of 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid (CID 22761566) is 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid.
What is the SMILES notation for 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid?
The canonical SMILES for 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid is Nc1nc(-c2ccccc2S(=O)(=O)O)cs1.
What is the InChIKey of 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid?
The InChIKey is OAVJTNJQTFTWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S2/c10-9-11-7(5-15-9)6-3-1-2-4-8(6)16(12,13)14/h1-5H,(H2,10,11)(H,12,13,14).
What are the key properties of 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid?
2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid has a molecular weight of 256.31 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-1,3-thiazol-4-yl)benzenesulfonic acid is sourced from PubChem (CID 22761566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).