About 3-ethenoxypropanoate
3-ethenoxypropanoate (PubChem CID 22762264) has the molecular formula C5H7O3-
and a molecular weight of 115.11 g/mol. Its IUPAC name is 3-ethenoxypropanoate.
Molecular Properties
| Compound Name | 3-ethenoxypropanoate |
| PubChem CID | 22762264 |
| Molecular Formula | C5H7O3- |
| Molecular Weight | 115.11 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 3-ethenoxypropanoate |
| SMILES | C=COCCC(=O)[O-] |
| InChI | InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h2H,1,3-4H2,(H,6,7)/p-1 |
| InChIKey | XUKWFDWKURBTFK-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.11 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxypropanoate?
The IUPAC name of 3-ethenoxypropanoate (CID 22762264) is 3-ethenoxypropanoate.
What is the SMILES notation for 3-ethenoxypropanoate?
The canonical SMILES for 3-ethenoxypropanoate is C=COCCC(=O)[O-].
What is the InChIKey of 3-ethenoxypropanoate?
The InChIKey is XUKWFDWKURBTFK-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h2H,1,3-4H2,(H,6,7)/p-1.
What are the key properties of 3-ethenoxypropanoate?
3-ethenoxypropanoate has a molecular weight of 115.11 g/mol, XLogP of -0.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxypropanoate is sourced from PubChem (CID 22762264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).