About 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine
7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine (PubChem CID 22762354) has the molecular formula C16H12F2N2S
and a molecular weight of 302.35 g/mol. Its IUPAC name is 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine.
Molecular Properties
| Compound Name | 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine |
| PubChem CID | 22762354 |
| Molecular Formula | C16H12F2N2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine |
| SMILES | CSC1=Nc2cc(F)c(F)cc2N=C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H12F2N2S/c1-21-16-9-13(10-5-3-2-4-6-10)19-14-7-11(17)12(18)8-15(14)20-16/h2-8H,9H2,1H3 |
| InChIKey | MTXAPNUSDWTKIG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine?
The IUPAC name of 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine (CID 22762354) is 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine.
What is the SMILES notation for 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine?
The canonical SMILES for 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine is CSC1=Nc2cc(F)c(F)cc2N=C(c2ccccc2)C1.
What is the InChIKey of 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine?
The InChIKey is MTXAPNUSDWTKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2S/c1-21-16-9-13(10-5-3-2-4-6-10)19-14-7-11(17)12(18)8-15(14)20-16/h2-8H,9H2,1H3.
What are the key properties of 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine?
7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine has a molecular weight of 302.35 g/mol, XLogP of 4.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-4-methylsulfanyl-2-phenyl-3H-1,5-benzodiazepine is sourced from PubChem (CID 22762354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).