C15H10Cl2N2S — CID 22762366
4-(3,4-dichlorophenyl)-1,3-dihydro-1,5-benzodiazepine-2-thione (PubChem CID 22762366) has the molecular formula C15H10Cl2N2S and a molecular weight of 321.23 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1,3-dihydro-1,5-benzodiazepine-2-thione.
| Compound Name | 4-(3,4-dichlorophenyl)-1,3-dihydro-1,5-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 22762366 |
| Molecular Formula | C15H10Cl2N2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1,3-dihydro-1,5-benzodiazepine-2-thione |
| SMILES | S=C1CC(c2ccc(Cl)c(Cl)c2)=Nc2ccccc2N1 |
| InChI | InChI=1S/C15H10Cl2N2S/c16-10-6-5-9(7-11(10)17)14-8-15(20)19-13-4-2-1-3-12(13)18-14/h1-7H,8H2,(H,19,20) |
| InChIKey | CZCNFXRNJHBSLA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|