C17H18Cl2OS — CID 22763000
4-(4-chlorophenyl)-1-(2-chlorophenyl)sulfanyl-2-methylbutan-2-ol (PubChem CID 22763000) has the molecular formula C17H18Cl2OS and a molecular weight of 341.30 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-(2-chlorophenyl)sulfanyl-2-methylbutan-2-ol.
| Compound Name | 4-(4-chlorophenyl)-1-(2-chlorophenyl)sulfanyl-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 22763000 |
| Molecular Formula | C17H18Cl2OS |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-(4-chlorophenyl)-1-(2-chlorophenyl)sulfanyl-2-methylbutan-2-ol |
| SMILES | CC(O)(CCc1ccc(Cl)cc1)CSc1ccccc1Cl |
| InChI | InChI=1S/C17H18Cl2OS/c1-17(20,11-10-13-6-8-14(18)9-7-13)12-21-16-5-3-2-4-15(16)19/h2-9,20H,10-12H2,1H3 |
| InChIKey | VUQLAXFIQPGYJH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |