About 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile
2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile (PubChem CID 22763131) has the molecular formula C15H14N2O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile |
| PubChem CID | 22763131 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile |
| SMILES | N#CCN1C(=O)c2ccccc2C2(CCCC2)C1=O |
| InChI | InChI=1S/C15H14N2O2/c16-9-10-17-13(18)11-5-1-2-6-12(11)15(14(17)19)7-3-4-8-15/h1-2,5-6H,3-4,7-8,10H2 |
| InChIKey | MXUYMUNTJVWXBK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile?
The IUPAC name of 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile (CID 22763131) is 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile.
What is the SMILES notation for 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile?
The canonical SMILES for 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile is N#CCN1C(=O)c2ccccc2C2(CCCC2)C1=O.
What is the InChIKey of 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile?
The InChIKey is MXUYMUNTJVWXBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c16-9-10-17-13(18)11-5-1-2-6-12(11)15(14(17)19)7-3-4-8-15/h1-2,5-6H,3-4,7-8,10H2.
What are the key properties of 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile?
2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile has a molecular weight of 254.29 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1',3'-dioxospiro[cyclopentane-1,4'-isoquinoline]-2'-yl)acetonitrile is sourced from PubChem (CID 22763131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).