About 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one
5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one (PubChem CID 22763184) has the molecular formula C16H20Cl2N2O
and a molecular weight of 327.26 g/mol. Its IUPAC name is 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one |
| PubChem CID | 22763184 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one |
| SMILES | CC(N(C)C)N1C(=O)C2(CCCC2)c2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C16H20Cl2N2O/c1-10(19(2)3)20-14-12(8-11(17)9-13(14)18)16(15(20)21)6-4-5-7-16/h8-10H,4-7H2,1-3H3 |
| InChIKey | WCEWASMIDXMXPK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one?
The IUPAC name of 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one (CID 22763184) is 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one.
What is the SMILES notation for 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one?
The canonical SMILES for 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one is CC(N(C)C)N1C(=O)C2(CCCC2)c2cc(Cl)cc(Cl)c21.
What is the InChIKey of 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one?
The InChIKey is WCEWASMIDXMXPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O/c1-10(19(2)3)20-14-12(8-11(17)9-13(14)18)16(15(20)21)6-4-5-7-16/h8-10H,4-7H2,1-3H3.
What are the key properties of 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one?
5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one has a molecular weight of 327.26 g/mol, XLogP of 4.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5',7'-dichloro-1'-[1-(dimethylamino)ethyl]spiro[cyclopentane-1,3'-indole]-2'-one is sourced from PubChem (CID 22763184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).