C15H9Cl6NO4S — CID 22763225
[3,4,6-trichloro-2-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl] propanoate (PubChem CID 22763225) has the molecular formula C15H9Cl6NO4S and a molecular weight of 512.03 g/mol. Its IUPAC name is [3,4,6-trichloro-2-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl] propanoate.
| Compound Name | [3,4,6-trichloro-2-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl] propanoate |
|---|---|
| PubChem CID | 22763225 |
| Molecular Formula | C15H9Cl6NO4S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 508.84 |
| IUPAC Name | [3,4,6-trichloro-2-[(2,4,5-trichlorophenyl)sulfamoyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(Cl)cc(Cl)c(Cl)c1S(=O)(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl6NO4S/c1-2-12(23)26-14-10(20)4-9(19)13(21)15(14)27(24,25)22-11-5-7(17)6(16)3-8(11)18/h3-5,22H,2H2,1H3 |
| InChIKey | NZHQMNPKMHPNSH-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|