About (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate
(2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate (PubChem CID 22763898) has the molecular formula C17H7F6N5O8
and a molecular weight of 523.26 g/mol. Its IUPAC name is (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate.
Molecular Properties
| Compound Name | (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate |
| PubChem CID | 22763898 |
| Molecular Formula | C17H7F6N5O8 |
| Molecular Weight | 523.26 g/mol |
| Exact Mass | 523.02 |
| IUPAC Name | (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])n1c(C(F)(F)F)nc2cc(C(F)(F)F)cc([N+](=O)[O-])c21 |
| InChI | InChI=1S/C17H7F6N5O8/c18-16(19,20)8-3-10-13(12(4-8)28(34)35)25(14(24-10)17(21,22)23)15(29)36-6-7-1-2-9(26(30)31)5-11(7)27(32)33/h1-5H,6H2 |
| InChIKey | DJJMZXYASLVSPL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 173.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.26 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate?
The IUPAC name of (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate (CID 22763898) is (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate.
What is the SMILES notation for (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate?
The canonical SMILES for (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate is O=C(OCc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])n1c(C(F)(F)F)nc2cc(C(F)(F)F)cc([N+](=O)[O-])c21.
What is the InChIKey of (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate?
The InChIKey is DJJMZXYASLVSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H7F6N5O8/c18-16(19,20)8-3-10-13(12(4-8)28(34)35)25(14(24-10)17(21,22)23)15(29)36-6-7-1-2-9(26(30)31)5-11(7)27(32)33/h1-5H,6H2.
What are the key properties of (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate?
(2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate has a molecular weight of 523.26 g/mol, XLogP of 4.98, 5 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dinitrophenyl)methyl 7-nitro-2,5-bis(trifluoromethyl)benzimidazole-1-carboxylate is sourced from PubChem (CID 22763898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).