About 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol
3-amino-4,7-dimethoxy-1H-isoindole-1-thiol (PubChem CID 22764164) has the molecular formula C10H12N2O2S
and a molecular weight of 224.29 g/mol. Its IUPAC name is 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol.
Molecular Properties
| Compound Name | 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol |
| PubChem CID | 22764164 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol |
| SMILES | COc1ccc(OC)c2c1C(N)=NC2S |
| InChI | InChI=1S/C10H12N2O2S/c1-13-5-3-4-6(14-2)8-7(5)9(11)12-10(8)15/h3-4,10,15H,1-2H3,(H2,11,12) |
| InChIKey | BVXHRLDPEUULKH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol?
The IUPAC name of 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol (CID 22764164) is 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol.
What is the SMILES notation for 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol?
The canonical SMILES for 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol is COc1ccc(OC)c2c1C(N)=NC2S.
What is the InChIKey of 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol?
The InChIKey is BVXHRLDPEUULKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-13-5-3-4-6(14-2)8-7(5)9(11)12-10(8)15/h3-4,10,15H,1-2H3,(H2,11,12).
What are the key properties of 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol?
3-amino-4,7-dimethoxy-1H-isoindole-1-thiol has a molecular weight of 224.29 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,7-dimethoxy-1H-isoindole-1-thiol is sourced from PubChem (CID 22764164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).