C27H21N3O6 — CID 22764796
1-[4-[[4,6-bis(4-acetylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]ethanone (PubChem CID 22764796) has the molecular formula C27H21N3O6 and a molecular weight of 483.48 g/mol. Its IUPAC name is 1-[4-[[4,6-bis(4-acetylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]ethanone.
| Compound Name | 1-[4-[[4,6-bis(4-acetylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]ethanone |
|---|---|
| PubChem CID | 22764796 |
| Molecular Formula | C27H21N3O6 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-[4-[[4,6-bis(4-acetylphenoxy)-1,3,5-triazin-2-yl]oxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Oc2nc(Oc3ccc(C(C)=O)cc3)nc(Oc3ccc(C(C)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C27H21N3O6/c1-16(31)19-4-10-22(11-5-19)34-25-28-26(35-23-12-6-20(7-13-23)17(2)32)30-27(29-25)36-24-14-8-21(9-15-24)18(3)33/h4-15H,1-3H3 |
| InChIKey | IDUIFIFZSHAOJY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |