C20H6F14N2O2 — CID 22764963
2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-benzoxazol-5-yl]-1,3-benzoxazole (PubChem CID 22764963) has the molecular formula C20H6F14N2O2 and a molecular weight of 572.25 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-benzoxazol-5-yl]-1,3-benzoxazole.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-benzoxazol-5-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 22764963 |
| Molecular Formula | C20H6F14N2O2 |
| Molecular Weight | 572.25 g/mol |
| Exact Mass | 572.02 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-[2-(1,1,2,2,3,3,3-heptafluoropropyl)-1,3-benzoxazol-5-yl]-1,3-benzoxazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)c1nc2cc(-c3ccc4oc(C(F)(F)C(F)(F)C(F)(F)F)nc4c3)ccc2o1 |
| InChI | InChI=1S/C20H6F14N2O2/c21-15(22,17(25,26)19(29,30)31)13-35-9-5-7(1-3-11(9)37-13)8-2-4-12-10(6-8)36-14(38-12)16(23,24)18(27,28)20(32,33)34/h1-6H |
| InChIKey | GYMMLSZICQPFQW-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.25 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|