About S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate
S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate (PubChem CID 22765024) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate.
Molecular Properties
| Compound Name | S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate |
| PubChem CID | 22765024 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate |
| SMILES | CCOc1ccc(SC(=O)NC2CCC2)cc1 |
| InChI | InChI=1S/C13H17NO2S/c1-2-16-11-6-8-12(9-7-11)17-13(15)14-10-4-3-5-10/h6-10H,2-5H2,1H3,(H,14,15) |
| InChIKey | REYFYPCUXNUTQG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate?
The IUPAC name of S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate (CID 22765024) is S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate.
What is the SMILES notation for S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate?
The canonical SMILES for S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate is CCOc1ccc(SC(=O)NC2CCC2)cc1.
What is the InChIKey of S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate?
The InChIKey is REYFYPCUXNUTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S/c1-2-16-11-6-8-12(9-7-11)17-13(15)14-10-4-3-5-10/h6-10H,2-5H2,1H3,(H,14,15).
What are the key properties of S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate?
S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate has a molecular weight of 251.35 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-ethoxyphenyl) N-cyclobutylcarbamothioate is sourced from PubChem (CID 22765024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).