About S-(4-methoxyphenyl) N-cyclohexylcarbamothioate
S-(4-methoxyphenyl) N-cyclohexylcarbamothioate (PubChem CID 22765027) has the molecular formula C14H19NO2S
and a molecular weight of 265.38 g/mol. Its IUPAC name is S-(4-methoxyphenyl) N-cyclohexylcarbamothioate.
Molecular Properties
| Compound Name | S-(4-methoxyphenyl) N-cyclohexylcarbamothioate |
| PubChem CID | 22765027 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | S-(4-methoxyphenyl) N-cyclohexylcarbamothioate |
| SMILES | COc1ccc(SC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C14H19NO2S/c1-17-12-7-9-13(10-8-12)18-14(16)15-11-5-3-2-4-6-11/h7-11H,2-6H2,1H3,(H,15,16) |
| InChIKey | YUUSRBHTCKBSSJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methoxyphenyl) N-cyclohexylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methoxyphenyl) N-cyclohexylcarbamothioate?
The IUPAC name of S-(4-methoxyphenyl) N-cyclohexylcarbamothioate (CID 22765027) is S-(4-methoxyphenyl) N-cyclohexylcarbamothioate.
What is the SMILES notation for S-(4-methoxyphenyl) N-cyclohexylcarbamothioate?
The canonical SMILES for S-(4-methoxyphenyl) N-cyclohexylcarbamothioate is COc1ccc(SC(=O)NC2CCCCC2)cc1.
What is the InChIKey of S-(4-methoxyphenyl) N-cyclohexylcarbamothioate?
The InChIKey is YUUSRBHTCKBSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2S/c1-17-12-7-9-13(10-8-12)18-14(16)15-11-5-3-2-4-6-11/h7-11H,2-6H2,1H3,(H,15,16).
What are the key properties of S-(4-methoxyphenyl) N-cyclohexylcarbamothioate?
S-(4-methoxyphenyl) N-cyclohexylcarbamothioate has a molecular weight of 265.38 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methoxyphenyl) N-cyclohexylcarbamothioate is sourced from PubChem (CID 22765027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).