C28H26S6 — CID 22765410
[1,2-bis(methylsulfanyl)-1,2,2-tris(phenylsulfanyl)ethyl]sulfanylbenzene (PubChem CID 22765410) has the molecular formula C28H26S6 and a molecular weight of 554.92 g/mol. Its IUPAC name is [1,2-bis(methylsulfanyl)-1,2,2-tris(phenylsulfanyl)ethyl]sulfanylbenzene.
| Compound Name | [1,2-bis(methylsulfanyl)-1,2,2-tris(phenylsulfanyl)ethyl]sulfanylbenzene |
|---|---|
| PubChem CID | 22765410 |
| Molecular Formula | C28H26S6 |
| Molecular Weight | 554.92 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | [1,2-bis(methylsulfanyl)-1,2,2-tris(phenylsulfanyl)ethyl]sulfanylbenzene |
| SMILES | CSC(Sc1ccccc1)(Sc1ccccc1)C(SC)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C28H26S6/c1-29-27(31-23-15-7-3-8-16-23,32-24-17-9-4-10-18-24)28(30-2,33-25-19-11-5-12-20-25)34-26-21-13-6-14-22-26/h3-22H,1-2H3 |
| InChIKey | QNYICRWLQNAKCK-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.92 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|