About 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine
8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine (PubChem CID 22765599) has the molecular formula C12H6F3NOS
and a molecular weight of 269.25 g/mol. Its IUPAC name is 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine.
Molecular Properties
| Compound Name | 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine |
| PubChem CID | 22765599 |
| Molecular Formula | C12H6F3NOS |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine |
| SMILES | FC(F)(F)c1ccc2c(c1)Sc1ncccc1O2 |
| InChI | InChI=1S/C12H6F3NOS/c13-12(14,15)7-3-4-8-10(6-7)18-11-9(17-8)2-1-5-16-11/h1-6H |
| InChIKey | FKXBUOXNOFOTSA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine?
The IUPAC name of 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine (CID 22765599) is 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine.
What is the SMILES notation for 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine?
The canonical SMILES for 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine is FC(F)(F)c1ccc2c(c1)Sc1ncccc1O2.
What is the InChIKey of 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine?
The InChIKey is FKXBUOXNOFOTSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6F3NOS/c13-12(14,15)7-3-4-8-10(6-7)18-11-9(17-8)2-1-5-16-11/h1-6H.
What are the key properties of 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine?
8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine has a molecular weight of 269.25 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(trifluoromethyl)-[1,4]benzoxathiino[3,2-b]pyridine is sourced from PubChem (CID 22765599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).