About 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one
7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one (PubChem CID 22765637) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one.
Molecular Properties
| Compound Name | 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one |
| PubChem CID | 22765637 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one |
| SMILES | Cc1ccc2c(c1)ncc1[nH]c(=O)oc12 |
| InChI | InChI=1S/C11H8N2O2/c1-6-2-3-7-8(4-6)12-5-9-10(7)15-11(14)13-9/h2-5H,1H3,(H,13,14) |
| InChIKey | DWBBNCCCEKQOAU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one?
The IUPAC name of 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one (CID 22765637) is 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one.
What is the SMILES notation for 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one?
The canonical SMILES for 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one is Cc1ccc2c(c1)ncc1[nH]c(=O)oc12.
What is the InChIKey of 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one?
The InChIKey is DWBBNCCCEKQOAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c1-6-2-3-7-8(4-6)12-5-9-10(7)15-11(14)13-9/h2-5H,1H3,(H,13,14).
What are the key properties of 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one?
7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one has a molecular weight of 200.20 g/mol, XLogP of 1.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3H-[1,3]oxazolo[4,5-c]quinolin-2-one is sourced from PubChem (CID 22765637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).