About heptan-3-one;propan-2-ol
heptan-3-one;propan-2-ol (PubChem CID 22766077) has the molecular formula C10H22O2
and a molecular weight of 174.28 g/mol. Its IUPAC name is heptan-3-one;propan-2-ol.
Molecular Properties
| Compound Name | heptan-3-one;propan-2-ol |
| PubChem CID | 22766077 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | heptan-3-one;propan-2-ol |
| SMILES | CC(C)O.CCCCC(=O)CC |
| InChI | InChI=1S/C7H14O.C3H8O/c1-3-5-6-7(8)4-2;1-3(2)4/h3-6H2,1-2H3;3-4H,1-2H3 |
| InChIKey | SCHVLWGIHORDFS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze heptan-3-one;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-3-one;propan-2-ol?
The IUPAC name of heptan-3-one;propan-2-ol (CID 22766077) is heptan-3-one;propan-2-ol.
What is the SMILES notation for heptan-3-one;propan-2-ol?
The canonical SMILES for heptan-3-one;propan-2-ol is CC(C)O.CCCCC(=O)CC.
What is the InChIKey of heptan-3-one;propan-2-ol?
The InChIKey is SCHVLWGIHORDFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C3H8O/c1-3-5-6-7(8)4-2;1-3(2)4/h3-6H2,1-2H3;3-4H,1-2H3.
What are the key properties of heptan-3-one;propan-2-ol?
heptan-3-one;propan-2-ol has a molecular weight of 174.28 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-3-one;propan-2-ol is sourced from PubChem (CID 22766077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).